C17H14F2N2O3 — CID 175776316
1-[4-(difluoromethoxy)phenyl]-7-ethoxy-1,8-naphthyridin-2-one (PubChem CID 175776316) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-7-ethoxy-1,8-naphthyridin-2-one.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-7-ethoxy-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 175776316 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-7-ethoxy-1,8-naphthyridin-2-one |
| SMILES | CCOc1ccc2ccc(=O)n(-c3ccc(OC(F)F)cc3)c2n1 |
| InChI | InChI=1S/C17H14F2N2O3/c1-2-23-14-9-3-11-4-10-15(22)21(16(11)20-14)12-5-7-13(8-6-12)24-17(18)19/h3-10,17H,2H2,1H3 |
| InChIKey | OKPLXSSANXRREJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |