C15H12F2N4O3 — CID 175835407
8-[4-(difluoromethoxy)phenyl]-2-ethoxypteridin-7-one (PubChem CID 175835407) has the molecular formula C15H12F2N4O3 and a molecular weight of 334.28 g/mol. Its IUPAC name is 8-[4-(difluoromethoxy)phenyl]-2-ethoxypteridin-7-one.
| Compound Name | 8-[4-(difluoromethoxy)phenyl]-2-ethoxypteridin-7-one |
|---|---|
| PubChem CID | 175835407 |
| Molecular Formula | C15H12F2N4O3 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 8-[4-(difluoromethoxy)phenyl]-2-ethoxypteridin-7-one |
| SMILES | CCOc1ncc2ncc(=O)n(-c3ccc(OC(F)F)cc3)c2n1 |
| InChI | InChI=1S/C15H12F2N4O3/c1-2-23-15-19-7-11-13(20-15)21(12(22)8-18-11)9-3-5-10(6-4-9)24-14(16)17/h3-8,14H,2H2,1H3 |
| InChIKey | AGJMAPZTRWWYIF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |