C16H13F2N5O2 — CID 165391315
2-(cyclopropylamino)-8-[4-(difluoromethoxy)phenyl]pteridin-7-one (PubChem CID 165391315) has the molecular formula C16H13F2N5O2 and a molecular weight of 345.31 g/mol. Its IUPAC name is 2-(cyclopropylamino)-8-[4-(difluoromethoxy)phenyl]pteridin-7-one.
| Compound Name | 2-(cyclopropylamino)-8-[4-(difluoromethoxy)phenyl]pteridin-7-one |
|---|---|
| PubChem CID | 165391315 |
| Molecular Formula | C16H13F2N5O2 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-(cyclopropylamino)-8-[4-(difluoromethoxy)phenyl]pteridin-7-one |
| SMILES | O=c1cnc2cnc(NC3CC3)nc2n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H13F2N5O2/c17-15(18)25-11-5-3-10(4-6-11)23-13(24)8-19-12-7-20-16(22-14(12)23)21-9-1-2-9/h3-9,15H,1-2H2,(H,20,21,22) |
| InChIKey | NLVOMUSKDFIUTR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |