C14H26F2N4O — CID 177057062
5-(difluoromethoxy)-N-piperidin-4-ylpyrimidin-2-amine;ethane (PubChem CID 177057062) has the molecular formula C14H26F2N4O and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-(difluoromethoxy)-N-piperidin-4-ylpyrimidin-2-amine;ethane.
| Compound Name | 5-(difluoromethoxy)-N-piperidin-4-ylpyrimidin-2-amine;ethane |
|---|---|
| PubChem CID | 177057062 |
| Molecular Formula | C14H26F2N4O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 5-(difluoromethoxy)-N-piperidin-4-ylpyrimidin-2-amine;ethane |
| SMILES | CC.CC.FC(F)Oc1cnc(NC2CCNCC2)nc1 |
| InChI | InChI=1S/C10H14F2N4O.2C2H6/c11-9(12)17-8-5-14-10(15-6-8)16-7-1-3-13-4-2-7;2*1-2/h5-7,9,13H,1-4H2,(H,14,15,16);2*1-2H3 |
| InChIKey | ZCMJXEYFINBODI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |