C14H20ClF2N3O2S — CID 178017432
N-[4-(3-chloropropylsulfinyl)cyclohexyl]-5-(difluoromethoxy)pyrimidin-2-amine (PubChem CID 178017432) has the molecular formula C14H20ClF2N3O2S and a molecular weight of 367.85 g/mol. Its IUPAC name is N-[4-(3-chloropropylsulfinyl)cyclohexyl]-5-(difluoromethoxy)pyrimidin-2-amine.
| Compound Name | N-[4-(3-chloropropylsulfinyl)cyclohexyl]-5-(difluoromethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 178017432 |
| Molecular Formula | C14H20ClF2N3O2S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[4-(3-chloropropylsulfinyl)cyclohexyl]-5-(difluoromethoxy)pyrimidin-2-amine |
| SMILES | O=S(CCCCl)C1CCC(Nc2ncc(OC(F)F)cn2)CC1 |
| InChI | InChI=1S/C14H20ClF2N3O2S/c15-6-1-7-23(21)12-4-2-10(3-5-12)20-14-18-8-11(9-19-14)22-13(16)17/h8-10,12-13H,1-7H2,(H,18,19,20) |
| InChIKey | XNXPTYIRKAMOMF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|