C25H21N5O4S — CID 171546685
N-[3-[5-ethynyl-2-(2-methoxyanilino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]cyclopropanesulfonamide (PubChem CID 171546685) has the molecular formula C25H21N5O4S and a molecular weight of 487.54 g/mol. Its IUPAC name is N-[3-[5-ethynyl-2-(2-methoxyanilino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]cyclopropanesulfonamide.
| Compound Name | N-[3-[5-ethynyl-2-(2-methoxyanilino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 171546685 |
| Molecular Formula | C25H21N5O4S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[3-[5-ethynyl-2-(2-methoxyanilino)-7-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]cyclopropanesulfonamide |
| SMILES | C#Cc1cc(=O)n(-c2cccc(NS(=O)(=O)C3CC3)c2)c2nc(Nc3ccccc3OC)ncc12 |
| InChI | InChI=1S/C25H21N5O4S/c1-3-16-13-23(31)30(18-8-6-7-17(14-18)29-35(32,33)19-11-12-19)24-20(16)15-26-25(28-24)27-21-9-4-5-10-22(21)34-2/h1,4-10,13-15,19,29H,11-12H2,2H3,(H,26,27,28) |
| InChIKey | MHUSRHNLYBZCLA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|