C24H25N5O — CID 171547313
8-cyclopentyl-5-ethynyl-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171547313) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 8-cyclopentyl-5-ethynyl-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-5-ethynyl-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171547313 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 8-cyclopentyl-5-ethynyl-2-[(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C#Cc1cc(=O)n(C2CCCC2)c2nc(Nc3cccc4c3CCN(C)C4)ncc12 |
| InChI | InChI=1S/C24H25N5O/c1-3-16-13-22(30)29(18-8-4-5-9-18)23-20(16)14-25-24(27-23)26-21-10-6-7-17-15-28(2)12-11-19(17)21/h1,6-7,10,13-14,18H,4-5,8-9,11-12,15H2,2H3,(H,25,26,27) |
| InChIKey | PVNFDKPAJZBWAG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|