C24H25N7O — CID 171546553
1-cyclopentyl-3-[5-ethynyl-2-[(2-methyl-1,3-dihydroisoindol-4-yl)amino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 171546553) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-cyclopentyl-3-[5-ethynyl-2-[(2-methyl-1,3-dihydroisoindol-4-yl)amino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-cyclopentyl-3-[5-ethynyl-2-[(2-methyl-1,3-dihydroisoindol-4-yl)amino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 171546553 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-cyclopentyl-3-[5-ethynyl-2-[(2-methyl-1,3-dihydroisoindol-4-yl)amino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | C#Cc1cc(NC(=O)NC2CCCC2)nc2nc(Nc3cccc4c3CN(C)C4)ncc12 |
| InChI | InChI=1S/C24H25N7O/c1-3-15-11-21(29-24(32)26-17-8-4-5-9-17)28-22-18(15)12-25-23(30-22)27-20-10-6-7-16-13-31(2)14-19(16)20/h1,6-7,10-12,17H,4-5,8-9,13-14H2,2H3,(H3,25,26,27,28,29,30,32) |
| InChIKey | NEIGLXUJLJMZPO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|