C28H33N7O3S — CID 171546484
1-cyclopentyl-3-[5-ethynyl-2-[2-[3-(methylsulfonylmethyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 171546484) has the molecular formula C28H33N7O3S and a molecular weight of 547.69 g/mol. Its IUPAC name is 1-cyclopentyl-3-[5-ethynyl-2-[2-[3-(methylsulfonylmethyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-cyclopentyl-3-[5-ethynyl-2-[2-[3-(methylsulfonylmethyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 171546484 |
| Molecular Formula | C28H33N7O3S |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 1-cyclopentyl-3-[5-ethynyl-2-[2-[3-(methylsulfonylmethyl)piperidin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | C#Cc1cc(NC(=O)NC2CCCC2)nc2nc(Nc3ccccc3N3CCCC(CS(C)(=O)=O)C3)ncc12 |
| InChI | InChI=1S/C28H33N7O3S/c1-3-20-15-25(33-28(36)30-21-10-4-5-11-21)32-26-22(20)16-29-27(34-26)31-23-12-6-7-13-24(23)35-14-8-9-19(17-35)18-39(2,37)38/h1,6-7,12-13,15-16,19,21H,4-5,8-11,14,17-18H2,2H3,(H3,29,30,31,32,33,34,36) |
| InChIKey | SAPRSHHMNHTDEY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|