C22H23N7O — CID 171546411
1-cyclopentyl-3-[5-ethynyl-2-[3-(methylamino)anilino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 171546411) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-cyclopentyl-3-[5-ethynyl-2-[3-(methylamino)anilino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-cyclopentyl-3-[5-ethynyl-2-[3-(methylamino)anilino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 171546411 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-cyclopentyl-3-[5-ethynyl-2-[3-(methylamino)anilino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | C#Cc1cc(NC(=O)NC2CCCC2)nc2nc(Nc3cccc(NC)c3)ncc12 |
| InChI | InChI=1S/C22H23N7O/c1-3-14-11-19(28-22(30)26-15-7-4-5-8-15)27-20-18(14)13-24-21(29-20)25-17-10-6-9-16(12-17)23-2/h1,6,9-13,15,23H,4-5,7-8H2,2H3,(H3,24,25,26,27,28,29,30) |
| InChIKey | XICPSQWQTUHFHW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|