C25H29N7O2 — CID 171546652
1-cyclopentyl-3-[2-[4-[2-(dimethylamino)ethoxy]anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 171546652) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-[4-[2-(dimethylamino)ethoxy]anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-cyclopentyl-3-[2-[4-[2-(dimethylamino)ethoxy]anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 171546652 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-cyclopentyl-3-[2-[4-[2-(dimethylamino)ethoxy]anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | C#Cc1cc(NC(=O)NC2CCCC2)nc2nc(Nc3ccc(OCCN(C)C)cc3)ncc12 |
| InChI | InChI=1S/C25H29N7O2/c1-4-17-15-22(30-25(33)28-18-7-5-6-8-18)29-23-21(17)16-26-24(31-23)27-19-9-11-20(12-10-19)34-14-13-32(2)3/h1,9-12,15-16,18H,5-8,13-14H2,2-3H3,(H3,26,27,28,29,30,31,33) |
| InChIKey | DSDOAFRVFZODGL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|