C25H28N8O2 — CID 171546462
1-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]-3-(oxetan-3-ylmethyl)urea (PubChem CID 171546462) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]-3-(oxetan-3-ylmethyl)urea.
| Compound Name | 1-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]-3-(oxetan-3-ylmethyl)urea |
|---|---|
| PubChem CID | 171546462 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 1-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]-3-(oxetan-3-ylmethyl)urea |
| SMILES | C#Cc1cc(NC(=O)NCC2COC2)nc2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc12 |
| InChI | InChI=1S/C25H28N8O2/c1-3-18-12-22(30-25(34)27-13-17-15-35-16-17)29-23-21(18)14-26-24(31-23)28-19-4-6-20(7-5-19)33-10-8-32(2)9-11-33/h1,4-7,12,14,17H,8-11,13,15-16H2,2H3,(H3,26,27,28,29,30,31,34) |
| InChIKey | OTGFUOBKNRWAFL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|