C31H39N9O — CID 171546241
1-[2-[3-(cyclobutylmethylamino)-4-(4-methylpiperazin-1-yl)anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]-3-cyclopentylurea (PubChem CID 171546241) has the molecular formula C31H39N9O and a molecular weight of 553.72 g/mol. Its IUPAC name is 1-[2-[3-(cyclobutylmethylamino)-4-(4-methylpiperazin-1-yl)anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]-3-cyclopentylurea.
| Compound Name | 1-[2-[3-(cyclobutylmethylamino)-4-(4-methylpiperazin-1-yl)anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 171546241 |
| Molecular Formula | C31H39N9O |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | 1-[2-[3-(cyclobutylmethylamino)-4-(4-methylpiperazin-1-yl)anilino]-5-ethynylpyrido[2,3-d]pyrimidin-7-yl]-3-cyclopentylurea |
| SMILES | C#Cc1cc(NC(=O)NC2CCCC2)nc2nc(Nc3ccc(N4CCN(C)CC4)c(NCC4CCC4)c3)ncc12 |
| InChI | InChI=1S/C31H39N9O/c1-3-22-17-28(37-31(41)35-23-9-4-5-10-23)36-29-25(22)20-33-30(38-29)34-24-11-12-27(40-15-13-39(2)14-16-40)26(18-24)32-19-21-7-6-8-21/h1,11-12,17-18,20-21,23,32H,4-10,13-16,19H2,2H3,(H3,33,34,35,36,37,38,41) |
| InChIKey | KCMCLCISONNRIK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|