C26H34N8O2 — CID 171547301
1-cyclopentyl-3-[5-[(5,8-dimethyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]-2-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 171547301) has the molecular formula C26H34N8O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 1-cyclopentyl-3-[5-[(5,8-dimethyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]-2-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-cyclopentyl-3-[5-[(5,8-dimethyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]-2-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 171547301 |
| Molecular Formula | C26H34N8O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 1-cyclopentyl-3-[5-[(5,8-dimethyl-7-oxopyrido[2,3-d]pyrimidin-2-yl)amino]-2-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | Cc1cc(=O)n(C)c2nc(Nc3ccc(N4CCN(C)CC4)c(NC(=O)NC4CCCC4)c3)ncc12 |
| InChI | InChI=1S/C26H34N8O2/c1-17-14-23(35)33(3)24-20(17)16-27-25(31-24)28-19-8-9-22(34-12-10-32(2)11-13-34)21(15-19)30-26(36)29-18-6-4-5-7-18/h8-9,14-16,18H,4-7,10-13H2,1-3H3,(H,27,28,31)(H2,29,30,36) |
| InChIKey | CSNJEEYFPYIVPR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|