C21H28N6O2 — CID 113049830
1-cyclohexyl-3-[6-(2-morpholin-4-ylanilino)pyridazin-3-yl]urea (PubChem CID 113049830) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-(2-morpholin-4-ylanilino)pyridazin-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[6-(2-morpholin-4-ylanilino)pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 113049830 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-cyclohexyl-3-[6-(2-morpholin-4-ylanilino)pyridazin-3-yl]urea |
| SMILES | O=C(Nc1ccc(Nc2ccccc2N2CCOCC2)nn1)NC1CCCCC1 |
| InChI | InChI=1S/C21H28N6O2/c28-21(22-16-6-2-1-3-7-16)24-20-11-10-19(25-26-20)23-17-8-4-5-9-18(17)27-12-14-29-15-13-27/h4-5,8-11,16H,1-3,6-7,12-15H2,(H,23,25)(H2,22,24,26,28) |
| InChIKey | SJWYFLRIFPSZJA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |