C24H30N4O4 — CID 2813234
benzyl 4-[(2-morpholin-4-ylphenyl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 2813234) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is benzyl 4-[(2-morpholin-4-ylphenyl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(2-morpholin-4-ylphenyl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 2813234 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | benzyl 4-[(2-morpholin-4-ylphenyl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)NC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N4O4/c29-23(26-21-8-4-5-9-22(21)27-14-16-31-17-15-27)25-20-10-12-28(13-11-20)24(30)32-18-19-6-2-1-3-7-19/h1-9,20H,10-18H2,(H2,25,26,29) |
| InChIKey | QFDUVFRRFXMBIF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |