C22H14F3N5O5S — CID 171546860
[6-cyano-2-(2-methoxyanilino)-7-oxo-8-phenylpyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate (PubChem CID 171546860) has the molecular formula C22H14F3N5O5S and a molecular weight of 517.45 g/mol. Its IUPAC name is [6-cyano-2-(2-methoxyanilino)-7-oxo-8-phenylpyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate.
| Compound Name | [6-cyano-2-(2-methoxyanilino)-7-oxo-8-phenylpyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171546860 |
| Molecular Formula | C22H14F3N5O5S |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | [6-cyano-2-(2-methoxyanilino)-7-oxo-8-phenylpyrido[2,3-d]pyrimidin-5-yl] trifluoromethanesulfonate |
| SMILES | COc1ccccc1Nc1ncc2c(OS(=O)(=O)C(F)(F)F)c(C#N)c(=O)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H14F3N5O5S/c1-34-17-10-6-5-9-16(17)28-21-27-12-15-18(35-36(32,33)22(23,24)25)14(11-26)20(31)30(19(15)29-21)13-7-3-2-4-8-13/h2-10,12H,1H3,(H,27,28,29) |
| InChIKey | LUABPCPAEJGJGA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|