C14H8F3NO6S — CID 141020632
3-cyano-4-methoxy-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylic acid (PubChem CID 141020632) has the molecular formula C14H8F3NO6S and a molecular weight of 375.28 g/mol. Its IUPAC name is 3-cyano-4-methoxy-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylic acid.
| Compound Name | 3-cyano-4-methoxy-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 141020632 |
| Molecular Formula | C14H8F3NO6S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 3-cyano-4-methoxy-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylic acid |
| SMILES | COc1c(C#N)c(OS(=O)(=O)C(F)(F)F)c(C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C14H8F3NO6S/c1-23-11-8-5-3-2-4-7(8)10(13(19)20)12(9(11)6-18)24-25(21,22)14(15,16)17/h2-5H,1H3,(H,19,20) |
| InChIKey | CXUKRLZETCVOTI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|