C29H19F3N2O7S — CID 157098552
methyl 3-cyano-2-ethenylnaphthalene-1-carboxylate;methyl 3-cyano-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate (PubChem CID 157098552) has the molecular formula C29H19F3N2O7S and a molecular weight of 596.54 g/mol. Its IUPAC name is methyl 3-cyano-2-ethenylnaphthalene-1-carboxylate;methyl 3-cyano-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate.
| Compound Name | methyl 3-cyano-2-ethenylnaphthalene-1-carboxylate;methyl 3-cyano-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 157098552 |
| Molecular Formula | C29H19F3N2O7S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 596.09 |
| IUPAC Name | methyl 3-cyano-2-ethenylnaphthalene-1-carboxylate;methyl 3-cyano-2-(trifluoromethylsulfonyloxy)naphthalene-1-carboxylate |
| SMILES | C=Cc1c(C#N)cc2ccccc2c1C(=O)OC.COC(=O)c1c(OS(=O)(=O)C(F)(F)F)c(C#N)cc2ccccc12 |
| InChI | InChI=1S/C15H11NO2.C14H8F3NO5S/c1-3-12-11(9-16)8-10-6-4-5-7-13(10)14(12)15(17)18-2;1-22-13(19)11-10-5-3-2-4-8(10)6-9(7-18)12(11)23-24(20,21)14(15,16)17/h3-8H,1H2,2H3;2-6H,1H3 |
| InChIKey | AFMMNPQNLRMGEL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 143.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|