C23H32N2O5SSi — CID 54295024
[1-[4-[tert-butyl(dimethyl)silyl]oxybutylcarbamoyl]-3-cyanonaphthalen-2-yl] methanesulfonate (PubChem CID 54295024) has the molecular formula C23H32N2O5SSi and a molecular weight of 476.67 g/mol. Its IUPAC name is [1-[4-[tert-butyl(dimethyl)silyl]oxybutylcarbamoyl]-3-cyanonaphthalen-2-yl] methanesulfonate.
| Compound Name | [1-[4-[tert-butyl(dimethyl)silyl]oxybutylcarbamoyl]-3-cyanonaphthalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 54295024 |
| Molecular Formula | C23H32N2O5SSi |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | [1-[4-[tert-butyl(dimethyl)silyl]oxybutylcarbamoyl]-3-cyanonaphthalen-2-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCNC(=O)c1c(OS(C)(=O)=O)c(C#N)cc2ccccc12 |
| InChI | InChI=1S/C23H32N2O5SSi/c1-23(2,3)32(5,6)29-14-10-9-13-25-22(26)20-19-12-8-7-11-17(19)15-18(16-24)21(20)30-31(4,27)28/h7-8,11-12,15H,9-10,13-14H2,1-6H3,(H,25,26) |
| InChIKey | SAERUEQLBHZWDT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|