C34H47N3O9 — CID 88622231
1-N,2-N,3-N-tris[4-(oxiran-2-ylmethoxy)butyl]naphthalene-1,2,3-tricarboxamide (PubChem CID 88622231) has the molecular formula C34H47N3O9 and a molecular weight of 641.76 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris[4-(oxiran-2-ylmethoxy)butyl]naphthalene-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris[4-(oxiran-2-ylmethoxy)butyl]naphthalene-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 88622231 |
| Molecular Formula | C34H47N3O9 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | 1-N,2-N,3-N-tris[4-(oxiran-2-ylmethoxy)butyl]naphthalene-1,2,3-tricarboxamide |
| SMILES | O=C(NCCCCOCC1CO1)c1cc2ccccc2c(C(=O)NCCCCOCC2CO2)c1C(=O)NCCCCOCC1CO1 |
| InChI | InChI=1S/C34H47N3O9/c38-32(35-11-3-6-14-41-18-25-21-44-25)29-17-24-9-1-2-10-28(24)30(33(39)36-12-4-7-15-42-19-26-22-45-26)31(29)34(40)37-13-5-8-16-43-20-27-23-46-27/h1-2,9-10,17,25-27H,3-8,11-16,18-23H2,(H,35,38)(H,36,39)(H,37,40) |
| InChIKey | GEOGCPRRNKWPOK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|