C30H48N2O7 — CID 88621988
3-[bis[4-(oxiran-2-ylmethoxy)butyl]amino]-N-[4-(oxiran-2-ylmethoxy)butyl]-3-phenylpropanamide (PubChem CID 88621988) has the molecular formula C30H48N2O7 and a molecular weight of 548.72 g/mol. Its IUPAC name is 3-[bis[4-(oxiran-2-ylmethoxy)butyl]amino]-N-[4-(oxiran-2-ylmethoxy)butyl]-3-phenylpropanamide.
| Compound Name | 3-[bis[4-(oxiran-2-ylmethoxy)butyl]amino]-N-[4-(oxiran-2-ylmethoxy)butyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 88621988 |
| Molecular Formula | C30H48N2O7 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | 3-[bis[4-(oxiran-2-ylmethoxy)butyl]amino]-N-[4-(oxiran-2-ylmethoxy)butyl]-3-phenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)N(CCCCOCC1CO1)CCCCOCC1CO1)NCCCCOCC1CO1 |
| InChI | InChI=1S/C30H48N2O7/c33-30(31-12-4-7-15-34-19-26-22-37-26)18-29(25-10-2-1-3-11-25)32(13-5-8-16-35-20-27-23-38-27)14-6-9-17-36-21-28-24-39-28/h1-3,10-11,26-29H,4-9,12-24H2,(H,31,33) |
| InChIKey | QLIGPSJKOAYGCU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|