2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate

C17H13F3O2 — CID 151561325

IUPAC2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate
SMILESC=Cc1cc2ccccc2c(C(=O)OCC(F)(F)F)c1C=C
InChIInChI=1S/C17H13F3O2/c1-3-11-9-12-7-5-6-8-14(12)15(13(11)4-2)16(21)22-10-17(18,19)20/h3-9H,1-2,10H2
InChIKeyQCNHKPJCVLZJSV-UHFFFAOYSA-N
MW306.28 g/mol
LogP4.84
Rot. Bonds4

About 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate

2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate (PubChem CID 151561325) has the molecular formula C17H13F3O2 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate.

Molecular Properties

Compound Name2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate
PubChem CID151561325
Molecular FormulaC17H13F3O2
Molecular Weight306.28 g/mol
Exact Mass306.09
IUPAC Name2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate
SMILESC=Cc1cc2ccccc2c(C(=O)OCC(F)(F)F)c1C=C
InChIInChI=1S/C17H13F3O2/c1-3-11-9-12-7-5-6-8-14(12)15(13(11)4-2)16(21)22-10-17(18,19)20/h3-9H,1-2,10H2
InChIKeyQCNHKPJCVLZJSV-UHFFFAOYSA-N
XLogP4.84
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.28
LogP ≤ 54.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate?
The IUPAC name of 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate (CID 151561325) is 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate?
The canonical SMILES for 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate is C=Cc1cc2ccccc2c(C(=O)OCC(F)(F)F)c1C=C.
What is the InChIKey of 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate?
The InChIKey is QCNHKPJCVLZJSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3O2/c1-3-11-9-12-7-5-6-8-14(12)15(13(11)4-2)16(21)22-10-17(18,19)20/h3-9H,1-2,10H2.
What are the key properties of 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate?
2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate has a molecular weight of 306.28 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate is sourced from PubChem (CID 151561325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).