C17H13F3O2 — CID 151561325
2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate (PubChem CID 151561325) has the molecular formula C17H13F3O2 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 151561325 |
| Molecular Formula | C17H13F3O2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2,2,2-trifluoroethyl 2,3-bis(ethenyl)naphthalene-1-carboxylate |
| SMILES | C=Cc1cc2ccccc2c(C(=O)OCC(F)(F)F)c1C=C |
| InChI | InChI=1S/C17H13F3O2/c1-3-11-9-12-7-5-6-8-14(12)15(13(11)4-2)16(21)22-10-17(18,19)20/h3-9H,1-2,10H2 |
| InChIKey | QCNHKPJCVLZJSV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |