C11H9F2O5S- — CID 59283783
2-(2-ethenylbenzoyl)oxy-1,1-difluoroethanesulfonate (PubChem CID 59283783) has the molecular formula C11H9F2O5S- and a molecular weight of 291.25 g/mol. Its IUPAC name is 2-(2-ethenylbenzoyl)oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-(2-ethenylbenzoyl)oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 59283783 |
| Molecular Formula | C11H9F2O5S- |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-(2-ethenylbenzoyl)oxy-1,1-difluoroethanesulfonate |
| SMILES | C=Cc1ccccc1C(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H10F2O5S/c1-2-8-5-3-4-6-9(8)10(14)18-7-11(12,13)19(15,16)17/h2-6H,1,7H2,(H,15,16,17)/p-1 |
| InChIKey | KJZGKCJUKSQSKD-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|