C17H13F2O8S2- — CID 176845935
2-[2-(4-ethenylphenyl)sulfonyloxybenzoyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 176845935) has the molecular formula C17H13F2O8S2- and a molecular weight of 447.41 g/mol. Its IUPAC name is 2-[2-(4-ethenylphenyl)sulfonyloxybenzoyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[2-(4-ethenylphenyl)sulfonyloxybenzoyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 176845935 |
| Molecular Formula | C17H13F2O8S2- |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | 2-[2-(4-ethenylphenyl)sulfonyloxybenzoyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)Oc2ccccc2C(=O)OCC(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C17H14F2O8S2/c1-2-12-7-9-13(10-8-12)28(21,22)27-15-6-4-3-5-14(15)16(20)26-11-17(18,19)29(23,24)25/h2-10H,1,11H2,(H,23,24,25)/p-1 |
| InChIKey | XCEUDWUXCZAAQE-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|