C7H6F2NO5S- — CID 155610354
1,1-difluoro-2-(1H-pyrrole-3-carbonyloxy)ethanesulfonate (PubChem CID 155610354) has the molecular formula C7H6F2NO5S- and a molecular weight of 254.19 g/mol. Its IUPAC name is 1,1-difluoro-2-(1H-pyrrole-3-carbonyloxy)ethanesulfonate.
| Compound Name | 1,1-difluoro-2-(1H-pyrrole-3-carbonyloxy)ethanesulfonate |
|---|---|
| PubChem CID | 155610354 |
| Molecular Formula | C7H6F2NO5S- |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1,1-difluoro-2-(1H-pyrrole-3-carbonyloxy)ethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])c1cc[nH]c1 |
| InChI | InChI=1S/C7H7F2NO5S/c8-7(9,16(12,13)14)4-15-6(11)5-1-2-10-3-5/h1-3,10H,4H2,(H,12,13,14)/p-1 |
| InChIKey | AYDPWKMUNFFSRK-UHFFFAOYSA-M |
| XLogP | 0.31 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|