C21H28F2NO9S- — CID 155610362
2-[4-[bis(2-butanoyloxyethyl)amino]benzoyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 155610362) has the molecular formula C21H28F2NO9S- and a molecular weight of 508.52 g/mol. Its IUPAC name is 2-[4-[bis(2-butanoyloxyethyl)amino]benzoyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[4-[bis(2-butanoyloxyethyl)amino]benzoyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 155610362 |
| Molecular Formula | C21H28F2NO9S- |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-[4-[bis(2-butanoyloxyethyl)amino]benzoyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | CCCC(=O)OCCN(CCOC(=O)CCC)c1ccc(C(=O)OCC(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C21H29F2NO9S/c1-3-5-18(25)31-13-11-24(12-14-32-19(26)6-4-2)17-9-7-16(8-10-17)20(27)33-15-21(22,23)34(28,29)30/h7-10H,3-6,11-15H2,1-2H3,(H,28,29,30)/p-1 |
| InChIKey | FDIAWCYTIRATDN-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|