C9H7ClF2O5S — CID 129070682
2-(4-chlorobenzoyl)oxy-1,1-difluoroethanesulfonic acid (PubChem CID 129070682) has the molecular formula C9H7ClF2O5S and a molecular weight of 300.67 g/mol. Its IUPAC name is 2-(4-chlorobenzoyl)oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(4-chlorobenzoyl)oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 129070682 |
| Molecular Formula | C9H7ClF2O5S |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 2-(4-chlorobenzoyl)oxy-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H7ClF2O5S/c10-7-3-1-6(2-4-7)8(13)17-5-9(11,12)18(14,15)16/h1-4H,5H2,(H,14,15,16) |
| InChIKey | QGXLLVUFUHFEQM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|