C18H14O6S2 — CID 176866025
4-(4-ethenylphenyl)sulfonyloxynaphthalene-1-sulfonic acid (PubChem CID 176866025) has the molecular formula C18H14O6S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-(4-ethenylphenyl)sulfonyloxynaphthalene-1-sulfonic acid.
| Compound Name | 4-(4-ethenylphenyl)sulfonyloxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 176866025 |
| Molecular Formula | C18H14O6S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 4-(4-ethenylphenyl)sulfonyloxynaphthalene-1-sulfonic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)Oc2ccc(S(=O)(=O)O)c3ccccc23)cc1 |
| InChI | InChI=1S/C18H14O6S2/c1-2-13-7-9-14(10-8-13)26(22,23)24-17-11-12-18(25(19,20)21)16-6-4-3-5-15(16)17/h2-12H,1H2,(H,19,20,21) |
| InChIKey | MTIASUKANNGWGW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|