ethenylsulfonyl 4-ethenylbenzenesulfonate

C10H10O5S2 — CID 57074743

IUPACethenylsulfonyl 4-ethenylbenzenesulfonate
SMILESC=Cc1ccc(S(=O)(=O)OS(=O)(=O)C=C)cc1
InChIInChI=1S/C10H10O5S2/c1-3-9-5-7-10(8-6-9)17(13,14)15-16(11,12)4-2/h3-8H,1-2H2
InChIKeyORQYOVLQQWQLJL-UHFFFAOYSA-N
MW274.32 g/mol
LogP1.51
Rot. Bonds5

About ethenylsulfonyl 4-ethenylbenzenesulfonate

ethenylsulfonyl 4-ethenylbenzenesulfonate (PubChem CID 57074743) has the molecular formula C10H10O5S2 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethenylsulfonyl 4-ethenylbenzenesulfonate.

Molecular Properties

Compound Nameethenylsulfonyl 4-ethenylbenzenesulfonate
PubChem CID57074743
Molecular FormulaC10H10O5S2
Molecular Weight274.32 g/mol
Exact Mass274.00
IUPAC Nameethenylsulfonyl 4-ethenylbenzenesulfonate
SMILESC=Cc1ccc(S(=O)(=O)OS(=O)(=O)C=C)cc1
InChIInChI=1S/C10H10O5S2/c1-3-9-5-7-10(8-6-9)17(13,14)15-16(11,12)4-2/h3-8H,1-2H2
InChIKeyORQYOVLQQWQLJL-UHFFFAOYSA-N
XLogP1.51
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 51.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethenylsulfonyl 4-ethenylbenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethenylsulfonyl 4-ethenylbenzenesulfonate?
The IUPAC name of ethenylsulfonyl 4-ethenylbenzenesulfonate (CID 57074743) is ethenylsulfonyl 4-ethenylbenzenesulfonate.
What is the SMILES notation for ethenylsulfonyl 4-ethenylbenzenesulfonate?
The canonical SMILES for ethenylsulfonyl 4-ethenylbenzenesulfonate is C=Cc1ccc(S(=O)(=O)OS(=O)(=O)C=C)cc1.
What is the InChIKey of ethenylsulfonyl 4-ethenylbenzenesulfonate?
The InChIKey is ORQYOVLQQWQLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5S2/c1-3-9-5-7-10(8-6-9)17(13,14)15-16(11,12)4-2/h3-8H,1-2H2.
What are the key properties of ethenylsulfonyl 4-ethenylbenzenesulfonate?
ethenylsulfonyl 4-ethenylbenzenesulfonate has a molecular weight of 274.32 g/mol, XLogP of 1.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylsulfonyl 4-ethenylbenzenesulfonate is sourced from PubChem (CID 57074743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).