About ethenylsulfonyl 4-ethenylbenzenesulfonate
ethenylsulfonyl 4-ethenylbenzenesulfonate (PubChem CID 57074743) has the molecular formula C10H10O5S2
and a molecular weight of 274.32 g/mol. Its IUPAC name is ethenylsulfonyl 4-ethenylbenzenesulfonate.
Molecular Properties
| Compound Name | ethenylsulfonyl 4-ethenylbenzenesulfonate |
| PubChem CID | 57074743 |
| Molecular Formula | C10H10O5S2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | ethenylsulfonyl 4-ethenylbenzenesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)OS(=O)(=O)C=C)cc1 |
| InChI | InChI=1S/C10H10O5S2/c1-3-9-5-7-10(8-6-9)17(13,14)15-16(11,12)4-2/h3-8H,1-2H2 |
| InChIKey | ORQYOVLQQWQLJL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethenylsulfonyl 4-ethenylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylsulfonyl 4-ethenylbenzenesulfonate?
The IUPAC name of ethenylsulfonyl 4-ethenylbenzenesulfonate (CID 57074743) is ethenylsulfonyl 4-ethenylbenzenesulfonate.
What is the SMILES notation for ethenylsulfonyl 4-ethenylbenzenesulfonate?
The canonical SMILES for ethenylsulfonyl 4-ethenylbenzenesulfonate is C=Cc1ccc(S(=O)(=O)OS(=O)(=O)C=C)cc1.
What is the InChIKey of ethenylsulfonyl 4-ethenylbenzenesulfonate?
The InChIKey is ORQYOVLQQWQLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5S2/c1-3-9-5-7-10(8-6-9)17(13,14)15-16(11,12)4-2/h3-8H,1-2H2.
What are the key properties of ethenylsulfonyl 4-ethenylbenzenesulfonate?
ethenylsulfonyl 4-ethenylbenzenesulfonate has a molecular weight of 274.32 g/mol, XLogP of 1.51, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylsulfonyl 4-ethenylbenzenesulfonate is sourced from PubChem (CID 57074743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).