C46H50O6S3 — CID 23435173
4-(benzenesulfonyloxy)naphthalene-1-sulfonate;tris(4-tert-butylphenyl)sulfanium (PubChem CID 23435173) has the molecular formula C46H50O6S3 and a molecular weight of 795.10 g/mol. Its IUPAC name is 4-(benzenesulfonyloxy)naphthalene-1-sulfonate;tris(4-tert-butylphenyl)sulfanium.
| Compound Name | 4-(benzenesulfonyloxy)naphthalene-1-sulfonate;tris(4-tert-butylphenyl)sulfanium |
|---|---|
| PubChem CID | 23435173 |
| Molecular Formula | C46H50O6S3 |
| Molecular Weight | 795.10 g/mol |
| Exact Mass | 794.28 |
| IUPAC Name | 4-(benzenesulfonyloxy)naphthalene-1-sulfonate;tris(4-tert-butylphenyl)sulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.O=S(=O)([O-])c1ccc(OS(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C30H39S.C16H12O6S2/c1-28(2,3)22-10-16-25(17-11-22)31(26-18-12-23(13-19-26)29(4,5)6)27-20-14-24(15-21-27)30(7,8)9;17-23(18,19)16-11-10-15(13-8-4-5-9-14(13)16)22-24(20,21)12-6-2-1-3-7-12/h10-21H,1-9H3;1-11H,(H,17,18,19)/q+1;/p-1 |
| InChIKey | WKTGXASTYYBLHZ-UHFFFAOYSA-M |
| XLogP | 11.19 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.10 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|