C34H28O5S2 — CID 157087741
9,10-dimethoxyanthracene-2-sulfonate;triphenylsulfanium (PubChem CID 157087741) has the molecular formula C34H28O5S2 and a molecular weight of 580.73 g/mol. Its IUPAC name is 9,10-dimethoxyanthracene-2-sulfonate;triphenylsulfanium.
| Compound Name | 9,10-dimethoxyanthracene-2-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 157087741 |
| Molecular Formula | C34H28O5S2 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 9,10-dimethoxyanthracene-2-sulfonate;triphenylsulfanium |
| SMILES | COc1c2ccccc2c(OC)c2cc(S(=O)(=O)[O-])ccc12.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C16H14O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-20-15-11-5-3-4-6-12(11)16(21-2)14-9-10(22(17,18)19)7-8-13(14)15/h1-15H;3-9H,1-2H3,(H,17,18,19)/q+1;/p-1 |
| InChIKey | AEHCBEIYYXBRFN-UHFFFAOYSA-M |
| XLogP | 7.70 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|