C14H7Cl2NaO3S — CID 23667874
sodium 9,10-dichloroanthracene-2-sulfonate (PubChem CID 23667874) has the molecular formula C14H7Cl2NaO3S and a molecular weight of 349.17 g/mol. Its IUPAC name is sodium 9,10-dichloroanthracene-2-sulfonate.
| Compound Name | sodium 9,10-dichloroanthracene-2-sulfonate |
|---|---|
| PubChem CID | 23667874 |
| Molecular Formula | C14H7Cl2NaO3S |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | sodium 9,10-dichloroanthracene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(Cl)c3ccccc3c(Cl)c2c1.[Na+] |
| InChI | InChI=1S/C14H8Cl2O3S.Na/c15-13-9-3-1-2-4-10(9)14(16)12-7-8(20(17,18)19)5-6-11(12)13;/h1-7H,(H,17,18,19);/q;+1/p-1 |
| InChIKey | PXHXJGWHMJQHAJ-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|