C26H18F6O3S2 — CID 23084989
3,4-bis(trifluoromethyl)benzenesulfonate;triphenylsulfanium (PubChem CID 23084989) has the molecular formula C26H18F6O3S2 and a molecular weight of 556.55 g/mol. Its IUPAC name is 3,4-bis(trifluoromethyl)benzenesulfonate;triphenylsulfanium.
| Compound Name | 3,4-bis(trifluoromethyl)benzenesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 23084989 |
| Molecular Formula | C26H18F6O3S2 |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 3,4-bis(trifluoromethyl)benzenesulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])c1ccc(C(F)(F)F)c(C(F)(F)F)c1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H4F6O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-7(10,11)5-2-1-4(18(15,16)17)3-6(5)8(12,13)14/h1-15H;1-3H,(H,15,16,17)/q+1;/p-1 |
| InChIKey | LGJTZAZQJZYYJP-UHFFFAOYSA-M |
| XLogP | 7.41 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|