C38H38F6O9S2 — CID 22057498
[3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate (PubChem CID 22057498) has the molecular formula C38H38F6O9S2 and a molecular weight of 816.84 g/mol. Its IUPAC name is [3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | [3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057498 |
| Molecular Formula | C38H38F6O9S2 |
| Molecular Weight | 816.84 g/mol |
| Exact Mass | 816.19 |
| IUPAC Name | [3,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2,4-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1cc(OCC(=O)OC(C)(C)C)cc([S+](c2ccccc2)c2ccccc2)c1.O=S(=O)([O-])c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C30H35O6S.C8H4F6O3S/c1-29(2,3)35-27(31)20-33-22-17-23(34-21-28(32)36-30(4,5)6)19-26(18-22)37(24-13-9-7-10-14-24)25-15-11-8-12-16-25;9-7(10,11)4-1-2-6(18(15,16)17)5(3-4)8(12,13)14/h7-19H,20-21H2,1-6H3;1-3H,(H,15,16,17)/q+1;/p-1 |
| InChIKey | VOUOGOKIXCZMNN-UHFFFAOYSA-M |
| XLogP | 8.85 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.84 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|