C25H17F5O4S2 — CID 23132917
(3-methoxyphenyl)-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 23132917) has the molecular formula C25H17F5O4S2 and a molecular weight of 540.53 g/mol. Its IUPAC name is (3-methoxyphenyl)-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | (3-methoxyphenyl)-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 23132917 |
| Molecular Formula | C25H17F5O4S2 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | (3-methoxyphenyl)-diphenylsulfanium;2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | COc1cccc([S+](c2ccccc2)c2ccccc2)c1.O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H17OS.C6HF5O3S/c1-20-16-9-8-14-19(15-16)21(17-10-4-2-5-11-17)18-12-6-3-7-13-18;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h2-15H,1H3;(H,12,13,14)/q+1;/p-1 |
| InChIKey | VIYRJHXJVUMJAR-UHFFFAOYSA-M |
| XLogP | 6.08 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|