C61H28F20O18S8 — CID 87388344
bis(bis[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]-phenylsulfanium);methanedisulfonate (PubChem CID 87388344) has the molecular formula C61H28F20O18S8 and a molecular weight of 1685.37 g/mol. Its IUPAC name is bis(bis[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]-phenylsulfanium);methanedisulfonate.
| Compound Name | bis(bis[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]-phenylsulfanium);methanedisulfonate |
|---|---|
| PubChem CID | 87388344 |
| Molecular Formula | C61H28F20O18S8 |
| Molecular Weight | 1685.37 g/mol |
| Exact Mass | 1683.87 |
| IUPAC Name | bis(bis[4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl]-phenylsulfanium);methanedisulfonate |
| SMILES | O=S(=O)(Oc1ccc([S+](c2ccccc2)c2ccc(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)cc1)c1c(F)c(F)c(F)c(F)c1F.O=S(=O)(Oc1ccc([S+](c2ccccc2)c2ccc(OS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)cc1)c1c(F)c(F)c(F)c(F)c1F.O=S(=O)([O-])CS(=O)(=O)[O-] |
| InChI | InChI=1S/2C30H13F10O6S3.CH4O6S2/c2*31-19-21(33)25(37)29(26(38)22(19)34)48(41,42)45-14-6-10-17(11-7-14)47(16-4-2-1-3-5-16)18-12-8-15(9-13-18)46-49(43,44)30-27(39)23(35)20(32)24(36)28(30)40;2-8(3,4)1-9(5,6)7/h2*1-13H;1H2,(H,2,3,4)(H,5,6,7)/q2*+1;/p-2 |
| InChIKey | MULLUJRTQMTPGV-UHFFFAOYSA-L |
| XLogP | 13.45 |
| TPSA | 287.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 107 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1685.37 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|