C32H33F5N2O4S2 — CID 18945738
bis[4-(dimethylamino)phenyl]-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 18945738) has the molecular formula C32H33F5N2O4S2 and a molecular weight of 668.75 g/mol. Its IUPAC name is bis[4-(dimethylamino)phenyl]-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | bis[4-(dimethylamino)phenyl]-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 18945738 |
| Molecular Formula | C32H33F5N2O4S2 |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.18 |
| IUPAC Name | bis[4-(dimethylamino)phenyl]-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CN(C)c1ccc([S+](c2ccc(OC(C)(C)C)cc2)c2ccc(N(C)C)cc2)cc1.O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H33N2OS.C6HF5O3S/c1-26(2,3)29-22-12-18-25(19-13-22)30(23-14-8-20(9-15-23)27(4)5)24-16-10-21(11-17-24)28(6)7;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h8-19H,1-7H3;(H,12,13,14)/q+1;/p-1 |
| InChIKey | LXWREHGUWJWHPC-UHFFFAOYSA-M |
| XLogP | 7.38 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|