C39H39F5O9S2 — CID 18945716
2,3,4,5,6-pentafluorobenzenesulfonate;tris[4-(oxan-2-yloxy)phenyl]sulfanium (PubChem CID 18945716) has the molecular formula C39H39F5O9S2 and a molecular weight of 810.86 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorobenzenesulfonate;tris[4-(oxan-2-yloxy)phenyl]sulfanium.
| Compound Name | 2,3,4,5,6-pentafluorobenzenesulfonate;tris[4-(oxan-2-yloxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 18945716 |
| Molecular Formula | C39H39F5O9S2 |
| Molecular Weight | 810.86 g/mol |
| Exact Mass | 810.20 |
| IUPAC Name | 2,3,4,5,6-pentafluorobenzenesulfonate;tris[4-(oxan-2-yloxy)phenyl]sulfanium |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F.c1cc([S+](c2ccc(OC3CCCCO3)cc2)c2ccc(OC3CCCCO3)cc2)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C33H39O6S.C6HF5O3S/c1-4-22-34-31(7-1)37-25-10-16-28(17-11-25)40(29-18-12-26(13-19-29)38-32-8-2-5-23-35-32)30-20-14-27(15-21-30)39-33-9-3-6-24-36-33;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h10-21,31-33H,1-9,22-24H2;(H,12,13,14)/q+1;/p-1 |
| InChIKey | CMVDOPWVHWKZKO-UHFFFAOYSA-M |
| XLogP | 8.78 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.86 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|