C37H45F3O6S2 — CID 157112654
trifluoromethanesulfonate;tris(4-cyclohexyloxyphenyl)sulfanium (PubChem CID 157112654) has the molecular formula C37H45F3O6S2 and a molecular weight of 706.89 g/mol. Its IUPAC name is trifluoromethanesulfonate;tris(4-cyclohexyloxyphenyl)sulfanium.
| Compound Name | trifluoromethanesulfonate;tris(4-cyclohexyloxyphenyl)sulfanium |
|---|---|
| PubChem CID | 157112654 |
| Molecular Formula | C37H45F3O6S2 |
| Molecular Weight | 706.89 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | trifluoromethanesulfonate;tris(4-cyclohexyloxyphenyl)sulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1cc([S+](c2ccc(OC3CCCCC3)cc2)c2ccc(OC3CCCCC3)cc2)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C36H45O3S.CHF3O3S/c1-4-10-28(11-5-1)37-31-16-22-34(23-17-31)40(35-24-18-32(19-25-35)38-29-12-6-2-7-13-29)36-26-20-33(21-27-36)39-30-14-8-3-9-15-30;2-1(3,4)8(5,6)7/h16-30H,1-15H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AHAMXZZWGXSGLM-UHFFFAOYSA-M |
| XLogP | 9.97 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.89 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|