C16H21F3N2O3S — CID 91265545
1-(4-cyclopentyloxyphenyl)-4-(trifluoromethylsulfonyl)piperazine (PubChem CID 91265545) has the molecular formula C16H21F3N2O3S and a molecular weight of 378.42 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-4-(trifluoromethylsulfonyl)piperazine.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-4-(trifluoromethylsulfonyl)piperazine |
|---|---|
| PubChem CID | 91265545 |
| Molecular Formula | C16H21F3N2O3S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-4-(trifluoromethylsulfonyl)piperazine |
| SMILES | O=S(=O)(N1CCN(c2ccc(OC3CCCC3)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O3S/c17-16(18,19)25(22,23)21-11-9-20(10-12-21)13-5-7-15(8-6-13)24-14-3-1-2-4-14/h5-8,14H,1-4,9-12H2 |
| InChIKey | JYYANWJTXNNAED-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|