C23H28F3NO7S — CID 53345567
[(2R)-2-hydroxy-2-methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propyl] methanesulfonate (PubChem CID 53345567) has the molecular formula C23H28F3NO7S and a molecular weight of 519.54 g/mol. Its IUPAC name is [(2R)-2-hydroxy-2-methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propyl] methanesulfonate.
| Compound Name | [(2R)-2-hydroxy-2-methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propyl] methanesulfonate |
|---|---|
| PubChem CID | 53345567 |
| Molecular Formula | C23H28F3NO7S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [(2R)-2-hydroxy-2-methyl-3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propyl] methanesulfonate |
| SMILES | C[C@@](O)(COc1ccc(N2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)cc1)COS(C)(=O)=O |
| InChI | InChI=1S/C23H28F3NO7S/c1-22(28,16-32-35(2,29)30)15-31-18-5-3-17(4-6-18)27-13-11-20(12-14-27)33-19-7-9-21(10-8-19)34-23(24,25)26/h3-10,20,28H,11-16H2,1-2H3/t22-/m1/s1 |
| InChIKey | HEJCDRUMPOHHQG-JOCHJYFZSA-N |
| XLogP | 3.74 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|