C21H24F3NO5 — CID 152737986
3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propane-1,2-diol (PubChem CID 152737986) has the molecular formula C21H24F3NO5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 152737986 |
| Molecular Formula | C21H24F3NO5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3-[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]propane-1,2-diol |
| SMILES | OCC(O)COc1ccc(N2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H24F3NO5/c22-21(23,24)30-20-7-5-18(6-8-20)29-19-9-11-25(12-10-19)15-1-3-17(4-2-15)28-14-16(27)13-26/h1-8,16,19,26-27H,9-14H2 |
| InChIKey | ZYZWSDJUXJYYLH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|