C32H32ClF3N4O7 — CID 70874841
(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]phenoxy]butan-2-ol (PubChem CID 70874841) has the molecular formula C32H32ClF3N4O7 and a molecular weight of 677.08 g/mol. Its IUPAC name is (2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]phenoxy]butan-2-ol.
| Compound Name | (2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 70874841 |
| Molecular Formula | C32H32ClF3N4O7 |
| Molecular Weight | 677.08 g/mol |
| Exact Mass | 676.19 |
| IUPAC Name | (2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]piperidin-1-yl]phenoxy]butan-2-ol |
| SMILES | O=[N+]([O-])c1cn(CC[C@@H](O)COc2ccc(N3CCC(Oc4ccc(OCc5ccc(OC(F)(F)F)cc5)cc4)CC3)cc2)c(Cl)n1 |
| InChI | InChI=1S/C32H32ClF3N4O7/c33-31-37-30(40(42)43)19-39(31)16-13-24(41)21-45-25-7-3-23(4-8-25)38-17-14-28(15-18-38)46-27-11-9-26(10-12-27)44-20-22-1-5-29(6-2-22)47-32(34,35)36/h1-12,19,24,28,41H,13-18,20-21H2/t24-/m1/s1 |
| InChIKey | POPUQGQLKFXWAV-XMMPIXPASA-N |
| XLogP | 6.80 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.08 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|