C18H21ClF3N5O4 — CID 23080233
1-(2-chloro-4-nitroimidazol-1-yl)-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 23080233) has the molecular formula C18H21ClF3N5O4 and a molecular weight of 463.84 g/mol. Its IUPAC name is 1-(2-chloro-4-nitroimidazol-1-yl)-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(2-chloro-4-nitroimidazol-1-yl)-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 23080233 |
| Molecular Formula | C18H21ClF3N5O4 |
| Molecular Weight | 463.84 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 1-(2-chloro-4-nitroimidazol-1-yl)-2-methyl-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | CC(O)(CN1CCN(c2ccc(OC(F)(F)F)cc2)CC1)Cn1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C18H21ClF3N5O4/c1-17(28,12-26-10-15(27(29)30)23-16(26)19)11-24-6-8-25(9-7-24)13-2-4-14(5-3-13)31-18(20,21)22/h2-5,10,28H,6-9,11-12H2,1H3 |
| InChIKey | PCEZBGODQNERCM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|