C18H21Cl2N5O5 — CID 69482297
[(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] 4-(4-chlorophenyl)piperazine-1-carboxylate (PubChem CID 69482297) has the molecular formula C18H21Cl2N5O5 and a molecular weight of 458.30 g/mol. Its IUPAC name is [(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] 4-(4-chlorophenyl)piperazine-1-carboxylate.
| Compound Name | [(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] 4-(4-chlorophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69482297 |
| Molecular Formula | C18H21Cl2N5O5 |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [(2R)-3-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxy-2-methylpropyl] 4-(4-chlorophenyl)piperazine-1-carboxylate |
| SMILES | C[C@](O)(COC(=O)N1CCN(c2ccc(Cl)cc2)CC1)Cn1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C18H21Cl2N5O5/c1-18(27,11-24-10-15(25(28)29)21-16(24)20)12-30-17(26)23-8-6-22(7-9-23)14-4-2-13(19)3-5-14/h2-5,10,27H,6-9,11-12H2,1H3/t18-/m1/s1 |
| InChIKey | JHEAVFLKZLZNDN-GOSISDBHSA-N |
| XLogP | 2.81 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|