C11H19ClN6O3 — CID 141088104
1-(4-aminopiperazin-1-yl)-3-(2-chloro-4-nitroimidazol-1-yl)-2-methylpropan-2-ol (PubChem CID 141088104) has the molecular formula C11H19ClN6O3 and a molecular weight of 318.77 g/mol. Its IUPAC name is 1-(4-aminopiperazin-1-yl)-3-(2-chloro-4-nitroimidazol-1-yl)-2-methylpropan-2-ol.
| Compound Name | 1-(4-aminopiperazin-1-yl)-3-(2-chloro-4-nitroimidazol-1-yl)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 141088104 |
| Molecular Formula | C11H19ClN6O3 |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(4-aminopiperazin-1-yl)-3-(2-chloro-4-nitroimidazol-1-yl)-2-methylpropan-2-ol |
| SMILES | CC(O)(CN1CCN(N)CC1)Cn1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C11H19ClN6O3/c1-11(19,7-15-2-4-17(13)5-3-15)8-16-6-9(18(20)21)14-10(16)12/h6,19H,2-5,7-8,13H2,1H3 |
| InChIKey | OZTXRIJNHJXPGC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|