C18H22N6O7S — CID 87733926
4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(2-nitrophenyl)sulfanylimidazol-1-yl]propyl]piperazine-1-carboxylic acid (PubChem CID 87733926) has the molecular formula C18H22N6O7S and a molecular weight of 466.48 g/mol. Its IUPAC name is 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(2-nitrophenyl)sulfanylimidazol-1-yl]propyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(2-nitrophenyl)sulfanylimidazol-1-yl]propyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87733926 |
| Molecular Formula | C18H22N6O7S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 4-[(2S)-2-hydroxy-2-methyl-3-[4-nitro-2-(2-nitrophenyl)sulfanylimidazol-1-yl]propyl]piperazine-1-carboxylic acid |
| SMILES | C[C@](O)(CN1CCN(C(=O)O)CC1)Cn1cc([N+](=O)[O-])nc1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N6O7S/c1-18(27,11-20-6-8-21(9-7-20)17(25)26)12-22-10-15(24(30)31)19-16(22)32-14-5-3-2-4-13(14)23(28)29/h2-5,10,27H,6-9,11-12H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | QTRNIDLJJUQJOJ-SFHVURJKSA-N |
| XLogP | 1.90 |
| TPSA | 168.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|