C28H28ClF3N6O7S — CID 172996509
4-[3-[2-(2-chloro-6-nitrophenyl)sulfanyl-4-nitroimidazol-1-yl]-2-hydroxy-2-methylpropyl]-2-prop-1-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid (PubChem CID 172996509) has the molecular formula C28H28ClF3N6O7S and a molecular weight of 685.08 g/mol. Its IUPAC name is 4-[3-[2-(2-chloro-6-nitrophenyl)sulfanyl-4-nitroimidazol-1-yl]-2-hydroxy-2-methylpropyl]-2-prop-1-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-[2-(2-chloro-6-nitrophenyl)sulfanyl-4-nitroimidazol-1-yl]-2-hydroxy-2-methylpropyl]-2-prop-1-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 172996509 |
| Molecular Formula | C28H28ClF3N6O7S |
| Molecular Weight | 685.08 g/mol |
| Exact Mass | 684.14 |
| IUPAC Name | 4-[3-[2-(2-chloro-6-nitrophenyl)sulfanyl-4-nitroimidazol-1-yl]-2-hydroxy-2-methylpropyl]-2-prop-1-enyl-3-[4-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
| SMILES | CC=CC1C(c2ccc(C(F)(F)F)cc2)N(CC(C)(O)Cn2cc([N+](=O)[O-])nc2Sc2c(Cl)cccc2[N+](=O)[O-])CCN1C(=O)O |
| InChI | InChI=1S/C28H28ClF3N6O7S/c1-3-5-20-23(17-8-10-18(11-9-17)28(30,31)32)34(12-13-36(20)26(39)40)15-27(2,41)16-35-14-22(38(44)45)33-25(35)46-24-19(29)6-4-7-21(24)37(42)43/h3-11,14,20,23,41H,12-13,15-16H2,1-2H3,(H,39,40) |
| InChIKey | QKUGAZMFSJXAOB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 168.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.08 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|