C21H21ClFN5O3 — CID 122460259
(2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3-fluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-methylpropan-2-ol (PubChem CID 122460259) has the molecular formula C21H21ClFN5O3 and a molecular weight of 445.88 g/mol. Its IUPAC name is (2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3-fluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-methylpropan-2-ol.
| Compound Name | (2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3-fluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 122460259 |
| Molecular Formula | C21H21ClFN5O3 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3-fluorophenyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-methylpropan-2-ol |
| SMILES | C[C@](O)(CN1CCc2nc(-c3cccc(F)c3)ccc2C1)Cn1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C21H21ClFN5O3/c1-21(29,13-27-11-19(28(30)31)25-20(27)22)12-26-8-7-18-15(10-26)5-6-17(24-18)14-3-2-4-16(23)9-14/h2-6,9,11,29H,7-8,10,12-13H2,1H3/t21-/m0/s1 |
| InChIKey | ZXQJWHONGYMVEH-NRFANRHFSA-N |
| XLogP | 3.46 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|